C16H22N4O2 — CID 11403887
5-[(3-butoxy-4-methoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 11403887) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-[(3-butoxy-4-methoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(3-butoxy-4-methoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 11403887 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-[(3-butoxy-4-methoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCCCOc1cc(Cc2cnc(N)nc2N)ccc1OC |
| InChI | InChI=1S/C16H22N4O2/c1-3-4-7-22-14-9-11(5-6-13(14)21-2)8-12-10-19-16(18)20-15(12)17/h5-6,9-10H,3-4,7-8H2,1-2H3,(H4,17,18,19,20) |
| InChIKey | DWUKVVALJWDAKP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|