C23H27N5O5S — CID 86737614
N-[4-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenoxy]propylsulfonyl]phenyl]acetamide (PubChem CID 86737614) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-[4-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenoxy]propylsulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenoxy]propylsulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 86737614 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[4-[3-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenoxy]propylsulfonyl]phenyl]acetamide |
| SMILES | COc1ccc(Cc2cnc(N)nc2N)cc1OCCCS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C23H27N5O5S/c1-15(29)27-18-5-7-19(8-6-18)34(30,31)11-3-10-33-21-13-16(4-9-20(21)32-2)12-17-14-26-23(25)28-22(17)24/h4-9,13-14H,3,10-12H2,1-2H3,(H,27,29)(H4,24,25,26,28) |
| InChIKey | ONRWMRGORCDZIO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|