C13H19Cl2N5O2 — CID 21280986
5-[(4-amino-3,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine;dihydrochloride (PubChem CID 21280986) has the molecular formula C13H19Cl2N5O2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 5-[(4-amino-3,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine;dihydrochloride.
| Compound Name | 5-[(4-amino-3,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 21280986 |
| Molecular Formula | C13H19Cl2N5O2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 5-[(4-amino-3,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine;dihydrochloride |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1N.Cl.Cl |
| InChI | InChI=1S/C13H17N5O2.2ClH/c1-19-9-4-7(5-10(20-2)11(9)14)3-8-6-17-13(16)18-12(8)15;;/h4-6H,3,14H2,1-2H3,(H4,15,16,17,18);2*1H |
| InChIKey | KALQTQSWCXHLSQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|