About Tetroxoprim
Tetroxoprim (PubChem CID 65450) has the molecular formula C16H22N4O4
and a molecular weight of 334.37 g/mol. Its IUPAC name is 5-[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | Tetroxoprim |
| PubChem CID | 65450 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 5-[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COCCOC1=C(C=C(C=C1OC)CC2=CN=C(N=C2N)N)OC |
| InChI | InChI=1S/C16H22N4O4/c1-21-4-5-24-14-12(22-2)7-10(8-13(14)23-3)6-11-9-19-16(18)20-15(11)17/h7-9H,4-6H2,1-3H3,(H4,17,18,19,20) |
| InChIKey | WSWJIZXMAUYHOE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | 349 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Tetroxoprim with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetroxoprim?
The IUPAC name of Tetroxoprim (CID 65450) is 5-[[3,5-dimethoxy-4-(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
What is the SMILES notation for Tetroxoprim?
The canonical SMILES for Tetroxoprim is COCCOC1=C(C=C(C=C1OC)CC2=CN=C(N=C2N)N)OC.
What is the InChIKey of Tetroxoprim?
The InChIKey is WSWJIZXMAUYHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O4/c1-21-4-5-24-14-12(22-2)7-10(8-13(14)23-3)6-11-9-19-16(18)20-15(11)17/h7-9H,4-6H2,1-3H3,(H4,17,18,19,20).
What are the key properties of Tetroxoprim?
Tetroxoprim has a molecular weight of 334.37 g/mol, XLogP of 0.60, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Tetroxoprim is sourced from PubChem (CID 65450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).