C12H12N4O2 — CID 26341
5-(1,3-benzodioxol-5-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 26341) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 26341 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cc2ccc3c(c2)OCO3)c(N)n1 |
| InChI | InChI=1S/C12H12N4O2/c13-11-8(5-15-12(14)16-11)3-7-1-2-9-10(4-7)18-6-17-9/h1-2,4-5H,3,6H2,(H4,13,14,15,16) |
| InChIKey | YBIRDHJXPIORJB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |