C13H16N4O3 — CID 10423570
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenol (PubChem CID 10423570) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 10423570 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1O |
| InChI | InChI=1S/C13H16N4O3/c1-19-9-4-7(5-10(20-2)11(9)18)3-8-6-16-13(15)17-12(8)14/h4-6,18H,3H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | HPOCGNHBIFZCAN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |