C17H24N4O4 — CID 14999854
5-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 14999854) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 14999854 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 5-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COCCOc1ccc(Cc2cnc(N)nc2N)cc1OCCOC |
| InChI | InChI=1S/C17H24N4O4/c1-22-5-7-24-14-4-3-12(10-15(14)25-8-6-23-2)9-13-11-20-17(19)21-16(13)18/h3-4,10-11H,5-9H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | LMMYDNOLGSNIBJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|