C14H20N4O2 — CID 142411421
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;ethane (PubChem CID 142411421) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;ethane.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;ethane |
|---|---|
| PubChem CID | 142411421 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxyphenol;ethane |
| SMILES | CC.COc1cc(Cc2cnc(N)nc2N)ccc1O |
| InChI | InChI=1S/C12H14N4O2.C2H6/c1-18-10-5-7(2-3-9(10)17)4-8-6-15-12(14)16-11(8)13;1-2/h2-3,5-6,17H,4H2,1H3,(H4,13,14,15,16);1-2H3 |
| InChIKey | ZDRBMLGFIKOZOS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |