C19H20N4O3 — CID 19081616
4-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]phenol (PubChem CID 19081616) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]phenol.
| Compound Name | 4-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]phenol |
|---|---|
| PubChem CID | 19081616 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]phenol |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(-c2ccc(O)cc2)c1OC |
| InChI | InChI=1S/C19H20N4O3/c1-25-16-9-11(7-13-10-22-19(21)23-18(13)20)8-15(17(16)26-2)12-3-5-14(24)6-4-12/h3-6,8-10,24H,7H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | GFFFPUQBCZYWTE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |