C23H24N4O4 — CID 173318816
5-[[3-(6-ethynyl-2,3-dimethoxyphenyl)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 173318816) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 5-[[3-(6-ethynyl-2,3-dimethoxyphenyl)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3-(6-ethynyl-2,3-dimethoxyphenyl)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 173318816 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 5-[[3-(6-ethynyl-2,3-dimethoxyphenyl)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | C#Cc1ccc(OC)c(OC)c1-c1cc(Cc2cnc(N)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N4O4/c1-6-14-7-8-17(28-2)21(31-5)19(14)16-10-13(11-18(29-3)20(16)30-4)9-15-12-26-23(25)27-22(15)24/h1,7-8,10-12H,9H2,2-5H3,(H4,24,25,26,27) |
| InChIKey | SXOHGHBPBAYQLK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|