C18H20N4O3 — CID 58664281
5-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]pent-4-yn-2-one (PubChem CID 58664281) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]pent-4-yn-2-one.
| Compound Name | 5-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]pent-4-yn-2-one |
|---|---|
| PubChem CID | 58664281 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]pent-4-yn-2-one |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C#CCC(C)=O)c1OC |
| InChI | InChI=1S/C18H20N4O3/c1-11(23)5-4-6-13-7-12(9-15(24-2)16(13)25-3)8-14-10-21-18(20)22-17(14)19/h7,9-10H,5,8H2,1-3H3,(H4,19,20,21,22) |
| InChIKey | POMSLJRTDUFMAE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|