C14H15IN4O4 — CID 23299745
2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 23299745) has the molecular formula C14H15IN4O4 and a molecular weight of 430.20 g/mol. Its IUPAC name is 2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 23299745 |
| Molecular Formula | C14H15IN4O4 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C14H15IN4O4/c1-22-10-4-7(2-8-5-18-14(17)19-13(8)16)3-9(15)12(10)23-6-11(20)21/h3-5H,2,6H2,1H3,(H,20,21)(H4,16,17,18,19) |
| InChIKey | GJRJBSLQELXDIL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|