C13H16N4O2 — CID 71372579
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-6-methylphenol (PubChem CID 71372579) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-6-methylphenol.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-6-methylphenol |
|---|---|
| PubChem CID | 71372579 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-6-methylphenol |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C)c1O |
| InChI | InChI=1S/C13H16N4O2/c1-7-3-8(5-10(19-2)11(7)18)4-9-6-16-13(15)17-12(9)14/h3,5-6,18H,4H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | UQIMTBOIPIUWEO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |