C25H22N4O4 — CID 67667220
2-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-1,7-diol (PubChem CID 67667220) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-1,7-diol.
| Compound Name | 2-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-1,7-diol |
|---|---|
| PubChem CID | 67667220 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-1,7-diol |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C#Cc2ccc3ccc(O)cc3c2O)c1OC |
| InChI | InChI=1S/C25H22N4O4/c1-32-21-11-14(10-18-13-28-25(27)29-24(18)26)9-17(23(21)33-2)6-5-16-4-3-15-7-8-19(30)12-20(15)22(16)31/h3-4,7-9,11-13,30-31H,10H2,1-2H3,(H4,26,27,28,29) |
| InChIKey | WXYVNGCEIHRWFU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|