C23H24N4NaO5P — CID 86752729
sodium [4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]phenyl]-ethoxyphosphinate (PubChem CID 86752729) has the molecular formula C23H24N4NaO5P and a molecular weight of 490.43 g/mol. Its IUPAC name is sodium [4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]phenyl]-ethoxyphosphinate.
| Compound Name | sodium [4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]phenyl]-ethoxyphosphinate |
|---|---|
| PubChem CID | 86752729 |
| Molecular Formula | C23H24N4NaO5P |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | sodium [4-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]phenyl]-ethoxyphosphinate |
| SMILES | CCOP(=O)([O-])c1ccc(C#Cc2cc(Cc3cnc(N)nc3N)cc(OC)c2OC)cc1.[Na+] |
| InChI | InChI=1S/C23H25N4O5P.Na/c1-4-32-33(28,29)19-9-6-15(7-10-19)5-8-17-11-16(13-20(30-2)21(17)31-3)12-18-14-26-23(25)27-22(18)24;/h6-7,9-11,13-14H,4,12H2,1-3H3,(H,28,29)(H4,24,25,26,27);/q;+1/p-1 |
| InChIKey | RGDZAHSXTMUQOS-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|