C28H26N4O4 — CID 19081577
ethyl 6-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-2-carboxylate (PubChem CID 19081577) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is ethyl 6-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-2-carboxylate.
| Compound Name | ethyl 6-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 19081577 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | ethyl 6-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]naphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2cc(C#Cc3cc(Cc4cnc(N)nc4N)cc(OC)c3OC)ccc2c1 |
| InChI | InChI=1S/C28H26N4O4/c1-4-36-27(33)22-10-9-19-11-17(5-7-20(19)15-22)6-8-21-12-18(14-24(34-2)25(21)35-3)13-23-16-31-28(30)32-26(23)29/h5,7,9-12,14-16H,4,13H2,1-3H3,(H4,29,30,31,32) |
| InChIKey | CEKVQQGPMYWMSU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|