C27H25N5O5 — CID 57013289
7-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 57013289) has the molecular formula C27H25N5O5 and a molecular weight of 499.53 g/mol. Its IUPAC name is 7-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 57013289 |
| Molecular Formula | C27H25N5O5 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 7-[2-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2,3-dimethoxyphenyl]ethynyl]-1-ethyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2ccc(C#Cc3cc(Cc4cnc(N)nc4N)cc(OC)c3OC)cc21 |
| InChI | InChI=1S/C27H25N5O5/c1-4-32-14-20(26(34)35)23(33)19-8-6-15(11-21(19)32)5-7-17-9-16(12-22(36-2)24(17)37-3)10-18-13-30-27(29)31-25(18)28/h6,8-9,11-14H,4,10H2,1-3H3,(H,34,35)(H4,28,29,30,31) |
| InChIKey | AYQUOGVDHBIWEM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|