C20H30N4O — CID 71377421
5-[(4-nonoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 71377421) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 5-[(4-nonoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(4-nonoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71377421 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 5-[(4-nonoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCCCCCCCCOc1ccc(Cc2cnc(N)nc2N)cc1 |
| InChI | InChI=1S/C20H30N4O/c1-2-3-4-5-6-7-8-13-25-18-11-9-16(10-12-18)14-17-15-23-20(22)24-19(17)21/h9-12,15H,2-8,13-14H2,1H3,(H4,21,22,23,24) |
| InChIKey | MOUTVHQIWRWWCA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|