C21H32N4O — CID 13112761
5-[(4-butoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 13112761) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-[(4-butoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(4-butoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 13112761 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 5-[(4-butoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCCCOc1c(CCC)cc(Cc2cnc(N)nc2N)cc1CCC |
| InChI | InChI=1S/C21H32N4O/c1-4-7-10-26-19-16(8-5-2)11-15(12-17(19)9-6-3)13-18-14-24-21(23)25-20(18)22/h11-12,14H,4-10,13H2,1-3H3,(H4,22,23,24,25) |
| InChIKey | OXRGQGLRPYROQW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|