C21H30N4O4 — CID 44530982
6-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-propylphenoxy]hexanoic acid (PubChem CID 44530982) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 6-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-propylphenoxy]hexanoic acid.
| Compound Name | 6-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-propylphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 44530982 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 6-[5-[(2,4-diaminopyrimidin-5-yl)methyl]-2-methoxy-3-propylphenoxy]hexanoic acid |
| SMILES | CCCc1cc(Cc2cnc(N)nc2N)cc(OCCCCCC(=O)O)c1OC |
| InChI | InChI=1S/C21H30N4O4/c1-3-7-15-10-14(11-16-13-24-21(23)25-20(16)22)12-17(19(15)28-2)29-9-6-4-5-8-18(26)27/h10,12-13H,3-9,11H2,1-2H3,(H,26,27)(H4,22,23,24,25) |
| InChIKey | CQKVEORALSFEDV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|