C27H38N8O6 — CID 158542775
1-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]-9-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]nonan-2-one (PubChem CID 158542775) has the molecular formula C27H38N8O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is 1-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]-9-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]nonan-2-one.
| Compound Name | 1-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]-9-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]nonan-2-one |
|---|---|
| PubChem CID | 158542775 |
| Molecular Formula | C27H38N8O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 1-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]-9-[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]nonan-2-one |
| SMILES | COc1nc(NCCCCCCCC(=O)COc2c(OC)cc(Cc3cnc(N)nc3N)cc2OC)nc(OC)n1 |
| InChI | InChI=1S/C27H38N8O6/c1-37-20-13-17(12-18-15-31-24(29)32-23(18)28)14-21(38-2)22(20)41-16-19(36)10-8-6-5-7-9-11-30-25-33-26(39-3)35-27(34-25)40-4/h13-15H,5-12,16H2,1-4H3,(H4,28,29,31,32)(H,30,33,34,35) |
| InChIKey | JRKLBQLYOLZWSH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 191.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|