C29H47ClN4O8 — CID 165180336
5-[[4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 165180336) has the molecular formula C29H47ClN4O8 and a molecular weight of 615.17 g/mol. Its IUPAC name is 5-[[4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 165180336 |
| Molecular Formula | C29H47ClN4O8 |
| Molecular Weight | 615.17 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | 5-[[4-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCOCCOCCOCCOCCOCCCCCCCl |
| InChI | InChI=1S/C29H47ClN4O8/c1-35-25-20-23(19-24-22-33-29(32)34-28(24)31)21-26(36-2)27(25)42-18-17-41-16-15-40-14-13-39-12-11-38-10-9-37-8-6-4-3-5-7-30/h20-22H,3-19H2,1-2H3,(H4,31,32,33,34) |
| InChIKey | OZCHZRTXSAQAFL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|