C14H15Cl2N3O3 — CID 12655207
4,6-dichloro-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine (PubChem CID 12655207) has the molecular formula C14H15Cl2N3O3 and a molecular weight of 344.20 g/mol. Its IUPAC name is 4,6-dichloro-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4,6-dichloro-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 12655207 |
| Molecular Formula | C14H15Cl2N3O3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4,6-dichloro-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-amine |
| SMILES | COc1cc(Cc2c(Cl)nc(N)nc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C14H15Cl2N3O3/c1-20-9-5-7(6-10(21-2)11(9)22-3)4-8-12(15)18-14(17)19-13(8)16/h5-6H,4H2,1-3H3,(H2,17,18,19) |
| InChIKey | SRUWYJAYOBVHSS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |