C14H16ClN3O3 — CID 628127
6-chloro-2-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine (PubChem CID 628127) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 6-chloro-2-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 628127 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 6-chloro-2-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine |
| SMILES | COc1cc(Cc2nc(N)cc(Cl)n2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16ClN3O3/c1-19-9-4-8(5-10(20-2)14(9)21-3)6-13-17-11(15)7-12(16)18-13/h4-5,7H,6H2,1-3H3,(H2,16,17,18) |
| InChIKey | VDKBVLWNXHKJHX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |