C14H18ClN3O3 — CID 53381610
4-(3,4,5-trimethoxyphenyl)pyridine-2,6-diamine;hydrochloride (PubChem CID 53381610) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)pyridine-2,6-diamine;hydrochloride.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)pyridine-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 53381610 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)pyridine-2,6-diamine;hydrochloride |
| SMILES | COc1cc(-c2cc(N)nc(N)c2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C14H17N3O3.ClH/c1-18-10-4-8(5-11(19-2)14(10)20-3)9-6-12(15)17-13(16)7-9;/h4-7H,1-3H3,(H4,15,16,17);1H |
| InChIKey | ZZRQIZVESGASAD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |