C17H19N5O3 — CID 69016736
4-hydrazinyl-6-(3,4,5-trimethoxyphenyl)quinazolin-2-amine (PubChem CID 69016736) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-hydrazinyl-6-(3,4,5-trimethoxyphenyl)quinazolin-2-amine.
| Compound Name | 4-hydrazinyl-6-(3,4,5-trimethoxyphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 69016736 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-hydrazinyl-6-(3,4,5-trimethoxyphenyl)quinazolin-2-amine |
| SMILES | COc1cc(-c2ccc3nc(N)nc(NN)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19N5O3/c1-23-13-7-10(8-14(24-2)15(13)25-3)9-4-5-12-11(6-9)16(22-19)21-17(18)20-12/h4-8H,19H2,1-3H3,(H3,18,20,21,22) |
| InChIKey | GWPSKWPHOFGKED-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|