About 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline
4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline (PubChem CID 89207272) has the molecular formula C17H21NO5
and a molecular weight of 319.36 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline.
Molecular Properties
| Compound Name | 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline |
| PubChem CID | 89207272 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline |
| SMILES | COc1cc(N)c(-c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C17H21NO5/c1-19-13-8-11(12(18)9-14(13)20-2)10-6-15(21-3)17(23-5)16(7-10)22-4/h6-9H,18H2,1-5H3 |
| InChIKey | XLVNJVLSIMJWFH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline?
The IUPAC name of 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline (CID 89207272) is 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline.
What is the SMILES notation for 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline?
The canonical SMILES for 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline is COc1cc(N)c(-c2cc(OC)c(OC)c(OC)c2)cc1OC.
What is the InChIKey of 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline?
The InChIKey is XLVNJVLSIMJWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO5/c1-19-13-8-11(12(18)9-14(13)20-2)10-6-15(21-3)17(23-5)16(7-10)22-4/h6-9H,18H2,1-5H3.
What are the key properties of 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline?
4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline has a molecular weight of 319.36 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline is sourced from PubChem (CID 89207272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).