C17H21NO5 — CID 89207272
4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline (PubChem CID 89207272) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline.
| Compound Name | 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 89207272 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4,5-dimethoxy-2-(3,4,5-trimethoxyphenyl)aniline |
| SMILES | COc1cc(N)c(-c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C17H21NO5/c1-19-13-8-11(12(18)9-14(13)20-2)10-6-15(21-3)17(23-5)16(7-10)22-4/h6-9H,18H2,1-5H3 |
| InChIKey | XLVNJVLSIMJWFH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|