C11H13N3O3 — CID 16767521
4,5-dimethoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline (PubChem CID 16767521) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | 4,5-dimethoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 16767521 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4,5-dimethoxy-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline |
| SMILES | COc1cc(N)c(-c2nnc(C)o2)cc1OC |
| InChI | InChI=1S/C11H13N3O3/c1-6-13-14-11(17-6)7-4-9(15-2)10(16-3)5-8(7)12/h4-5H,12H2,1-3H3 |
| InChIKey | ISEPOMATBWVGJM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|