C14H19N3O3 — CID 29279587
2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,5-dimethoxyaniline (PubChem CID 29279587) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,5-dimethoxyaniline.
| Compound Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 29279587 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(-c2nc(C(C)(C)C)no2)cc1OC |
| InChI | InChI=1S/C14H19N3O3/c1-14(2,3)13-16-12(20-17-13)8-6-10(18-4)11(19-5)7-9(8)15/h6-7H,15H2,1-5H3 |
| InChIKey | NKPUIVCHOLJYKU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|