C14H19N3O — CID 55177691
2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,6-dimethylaniline (PubChem CID 55177691) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,6-dimethylaniline.
| Compound Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,6-dimethylaniline |
|---|---|
| PubChem CID | 55177691 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(-c2nc(C(C)(C)C)no2)c1 |
| InChI | InChI=1S/C14H19N3O/c1-8-6-9(2)11(15)10(7-8)12-16-13(17-18-12)14(3,4)5/h6-7H,15H2,1-5H3 |
| InChIKey | HBHVOMKXZOYCDU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|