C11H13N3O2 — CID 102706044
5-(5-methoxy-1,3,4-oxadiazol-2-yl)-2,4-dimethylaniline (PubChem CID 102706044) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-(5-methoxy-1,3,4-oxadiazol-2-yl)-2,4-dimethylaniline.
| Compound Name | 5-(5-methoxy-1,3,4-oxadiazol-2-yl)-2,4-dimethylaniline |
|---|---|
| PubChem CID | 102706044 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 5-(5-methoxy-1,3,4-oxadiazol-2-yl)-2,4-dimethylaniline |
| SMILES | COc1nnc(-c2cc(N)c(C)cc2C)o1 |
| InChI | InChI=1S/C11H13N3O2/c1-6-4-7(2)9(12)5-8(6)10-13-14-11(15-3)16-10/h4-5H,12H2,1-3H3 |
| InChIKey | SSXDQBYJCDCXKL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|