C16H15N3O — CID 102706038
2,4-dimethyl-5-(5-phenyl-1,3,4-oxadiazol-2-yl)aniline (PubChem CID 102706038) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-(5-phenyl-1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | 2,4-dimethyl-5-(5-phenyl-1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 102706038 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2,4-dimethyl-5-(5-phenyl-1,3,4-oxadiazol-2-yl)aniline |
| SMILES | Cc1cc(C)c(-c2nnc(-c3ccccc3)o2)cc1N |
| InChI | InChI=1S/C16H15N3O/c1-10-8-11(2)14(17)9-13(10)16-19-18-15(20-16)12-6-4-3-5-7-12/h3-9H,17H2,1-2H3 |
| InChIKey | MKOZKSGWESNTLJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|