C14H12N2O — CID 155036238
5-methyl-2-phenyl-1,3-benzoxazol-6-amine (PubChem CID 155036238) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-methyl-2-phenyl-1,3-benzoxazol-6-amine.
| Compound Name | 5-methyl-2-phenyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 155036238 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 5-methyl-2-phenyl-1,3-benzoxazol-6-amine |
| SMILES | Cc1cc2nc(-c3ccccc3)oc2cc1N |
| InChI | InChI=1S/C14H12N2O/c1-9-7-12-13(8-11(9)15)17-14(16-12)10-5-3-2-4-6-10/h2-8H,15H2,1H3 |
| InChIKey | NGKMJJBMDIYLEK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|