C17H20N2O2 — CID 163607211
2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol;methane (PubChem CID 163607211) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol;methane.
| Compound Name | 2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol;methane |
|---|---|
| PubChem CID | 163607211 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-(5-amino-2-phenyl-1,3-benzoxazol-6-yl)propan-2-ol;methane |
| SMILES | C.CC(C)(O)c1cc2oc(-c3ccccc3)nc2cc1N |
| InChI | InChI=1S/C16H16N2O2.CH4/c1-16(2,19)11-8-14-13(9-12(11)17)18-15(20-14)10-6-4-3-5-7-10;/h3-9,19H,17H2,1-2H3;1H4 |
| InChIKey | HCUNIZLMIAZNER-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|