C18H20N2O2 — CID 58709704
(2R)-2-amino-2-methyl-4-(2-phenyl-1,3-benzoxazol-5-yl)butan-1-ol (PubChem CID 58709704) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R)-2-amino-2-methyl-4-(2-phenyl-1,3-benzoxazol-5-yl)butan-1-ol.
| Compound Name | (2R)-2-amino-2-methyl-4-(2-phenyl-1,3-benzoxazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 58709704 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2R)-2-amino-2-methyl-4-(2-phenyl-1,3-benzoxazol-5-yl)butan-1-ol |
| SMILES | C[C@](N)(CO)CCc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C18H20N2O2/c1-18(19,12-21)10-9-13-7-8-16-15(11-13)20-17(22-16)14-5-3-2-4-6-14/h2-8,11,21H,9-10,12,19H2,1H3/t18-/m1/s1 |
| InChIKey | YZPSKWAENWBDPI-GOSISDBHSA-N |
| XLogP | 3.14 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |