C14H10BrNO2 — CID 83949668
[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]methanol (PubChem CID 83949668) has the molecular formula C14H10BrNO2 and a molecular weight of 304.14 g/mol. Its IUPAC name is [2-(4-bromophenyl)-1,3-benzoxazol-5-yl]methanol.
| Compound Name | [2-(4-bromophenyl)-1,3-benzoxazol-5-yl]methanol |
|---|---|
| PubChem CID | 83949668 |
| Molecular Formula | C14H10BrNO2 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | [2-(4-bromophenyl)-1,3-benzoxazol-5-yl]methanol |
| SMILES | OCc1ccc2oc(-c3ccc(Br)cc3)nc2c1 |
| InChI | InChI=1S/C14H10BrNO2/c15-11-4-2-10(3-5-11)14-16-12-7-9(8-17)1-6-13(12)18-14/h1-7,17H,8H2 |
| InChIKey | YIPPMYDFWNLIRA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |