C8H6FNO2 — CID 131118958
(2-fluoro-1,3-benzoxazol-5-yl)methanol (PubChem CID 131118958) has the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. Its IUPAC name is (2-fluoro-1,3-benzoxazol-5-yl)methanol.
| Compound Name | (2-fluoro-1,3-benzoxazol-5-yl)methanol |
|---|---|
| PubChem CID | 131118958 |
| Molecular Formula | C8H6FNO2 |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | (2-fluoro-1,3-benzoxazol-5-yl)methanol |
| SMILES | OCc1ccc2oc(F)nc2c1 |
| InChI | InChI=1S/C8H6FNO2/c9-8-10-6-3-5(4-11)1-2-7(6)12-8/h1-3,11H,4H2 |
| InChIKey | NFMNCAQFBXSAOG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |