C16H12ClNO2 — CID 82357890
[2-[(E)-2-(4-chlorophenyl)ethenyl]-1,3-benzoxazol-5-yl]methanol (PubChem CID 82357890) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is [2-[(E)-2-(4-chlorophenyl)ethenyl]-1,3-benzoxazol-5-yl]methanol.
| Compound Name | [2-[(E)-2-(4-chlorophenyl)ethenyl]-1,3-benzoxazol-5-yl]methanol |
|---|---|
| PubChem CID | 82357890 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [2-[(E)-2-(4-chlorophenyl)ethenyl]-1,3-benzoxazol-5-yl]methanol |
| SMILES | OCc1ccc2oc(/C=C/c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C16H12ClNO2/c17-13-5-1-11(2-6-13)4-8-16-18-14-9-12(10-19)3-7-15(14)20-16/h1-9,19H,10H2/b8-4+ |
| InChIKey | UKYYIBBDOYJBKH-XBXARRHUSA-N |
| XLogP | 4.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |