About 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride
5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride (PubChem CID 131030463) has the molecular formula C9H6ClNO3
and a molecular weight of 211.60 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride |
| PubChem CID | 131030463 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride |
| SMILES | O=C(Cl)c1nc2cc(CO)ccc2o1 |
| InChI | InChI=1S/C9H6ClNO3/c10-8(13)9-11-6-3-5(4-12)1-2-7(6)14-9/h1-3,12H,4H2 |
| InChIKey | AWSGOAWFEXPNRU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride?
The IUPAC name of 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride (CID 131030463) is 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride.
What is the SMILES notation for 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride?
The canonical SMILES for 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride is O=C(Cl)c1nc2cc(CO)ccc2o1.
What is the InChIKey of 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride?
The InChIKey is AWSGOAWFEXPNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO3/c10-8(13)9-11-6-3-5(4-12)1-2-7(6)14-9/h1-3,12H,4H2.
What are the key properties of 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride?
5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride has a molecular weight of 211.60 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride is sourced from PubChem (CID 131030463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).