C9H6ClNO3 — CID 131030463
5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride (PubChem CID 131030463) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride.
| Compound Name | 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride |
|---|---|
| PubChem CID | 131030463 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5-(hydroxymethyl)-1,3-benzoxazole-2-carbonyl chloride |
| SMILES | O=C(Cl)c1nc2cc(CO)ccc2o1 |
| InChI | InChI=1S/C9H6ClNO3/c10-8(13)9-11-6-3-5(4-12)1-2-7(6)14-9/h1-3,12H,4H2 |
| InChIKey | AWSGOAWFEXPNRU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|