C8H4ClNO3 — CID 131010337
5-hydroxy-1,3-benzoxazole-2-carbonyl chloride (PubChem CID 131010337) has the molecular formula C8H4ClNO3 and a molecular weight of 197.58 g/mol. Its IUPAC name is 5-hydroxy-1,3-benzoxazole-2-carbonyl chloride.
| Compound Name | 5-hydroxy-1,3-benzoxazole-2-carbonyl chloride |
|---|---|
| PubChem CID | 131010337 |
| Molecular Formula | C8H4ClNO3 |
| Molecular Weight | 197.58 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 5-hydroxy-1,3-benzoxazole-2-carbonyl chloride |
| SMILES | O=C(Cl)c1nc2cc(O)ccc2o1 |
| InChI | InChI=1S/C8H4ClNO3/c9-7(12)8-10-5-3-4(11)1-2-6(5)13-8/h1-3,11H |
| InChIKey | OXPKHJOESFTOII-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|