C8H3ClKNO3 — CID 156621025
potassium 5-chloro-1,3-benzoxazole-2-carboxylate (PubChem CID 156621025) has the molecular formula C8H3ClKNO3 and a molecular weight of 235.67 g/mol. Its IUPAC name is potassium 5-chloro-1,3-benzoxazole-2-carboxylate.
| Compound Name | potassium 5-chloro-1,3-benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 156621025 |
| Molecular Formula | C8H3ClKNO3 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 234.94 |
| IUPAC Name | potassium 5-chloro-1,3-benzoxazole-2-carboxylate |
| SMILES | O=C([O-])c1nc2cc(Cl)ccc2o1.[K+] |
| InChI | InChI=1S/C8H4ClNO3.K/c9-4-1-2-6-5(3-4)10-7(13-6)8(11)12;/h1-3H,(H,11,12);/q;+1/p-1 |
| InChIKey | PNWKXWDBLXRILF-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |