C9H6ClNO2S — CID 119089889
O-methyl 5-chloro-1,3-benzoxazole-2-carbothioate (PubChem CID 119089889) has the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. Its IUPAC name is O-methyl 5-chloro-1,3-benzoxazole-2-carbothioate.
| Compound Name | O-methyl 5-chloro-1,3-benzoxazole-2-carbothioate |
|---|---|
| PubChem CID | 119089889 |
| Molecular Formula | C9H6ClNO2S |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | O-methyl 5-chloro-1,3-benzoxazole-2-carbothioate |
| SMILES | COC(=S)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C9H6ClNO2S/c1-12-9(14)8-11-6-4-5(10)2-3-7(6)13-8/h2-4H,1H3 |
| InChIKey | KMZKVZQLVQYXOM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|