C10H8ClNO2 — CID 135996985
(Z)-1-(5-chloro-1,3-benzoxazol-2-yl)prop-1-en-2-ol (PubChem CID 135996985) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is (Z)-1-(5-chloro-1,3-benzoxazol-2-yl)prop-1-en-2-ol.
| Compound Name | (Z)-1-(5-chloro-1,3-benzoxazol-2-yl)prop-1-en-2-ol |
|---|---|
| PubChem CID | 135996985 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | (Z)-1-(5-chloro-1,3-benzoxazol-2-yl)prop-1-en-2-ol |
| SMILES | C/C(O)=C/c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C10H8ClNO2/c1-6(13)4-10-12-8-5-7(11)2-3-9(8)14-10/h2-5,13H,1H3/b6-4- |
| InChIKey | GPEKAUNTZLZYDR-XQRVVYSFSA-N |
| XLogP | 3.40 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|