C19H16ClNO4 — CID 70456671
ethyl (Z)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 70456671) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is ethyl (Z)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 70456671 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | ethyl (Z)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(OC)cc1)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C19H16ClNO4/c1-3-24-19(22)15(10-12-4-7-14(23-2)8-5-12)18-21-16-11-13(20)6-9-17(16)25-18/h4-11H,3H2,1-2H3/b15-10- |
| InChIKey | YHPSTKGBYNTNII-GDNBJRDFSA-N |
| XLogP | 4.59 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|