C10H10N2O3 — CID 118999769
ethyl 5-amino-1,3-benzoxazole-2-carboxylate (PubChem CID 118999769) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is ethyl 5-amino-1,3-benzoxazole-2-carboxylate.
| Compound Name | ethyl 5-amino-1,3-benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 118999769 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | ethyl 5-amino-1,3-benzoxazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C10H10N2O3/c1-2-14-10(13)9-12-7-5-6(11)3-4-8(7)15-9/h3-5H,2,11H2,1H3 |
| InChIKey | OXTDWVGRGVECJL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|