C11H12N2O5S — CID 79972161
methyl 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetate (PubChem CID 79972161) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is methyl 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetate.
| Compound Name | methyl 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetate |
|---|---|
| PubChem CID | 79972161 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | methyl 2-[(5-amino-1,3-benzoxazol-2-yl)methylsulfonyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)Cc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C11H12N2O5S/c1-17-11(14)6-19(15,16)5-10-13-8-4-7(12)2-3-9(8)18-10/h2-4H,5-6,12H2,1H3 |
| InChIKey | XWLVGWKVQCQSLH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|