C16H22N2O2 — CID 79973320
2-[(3,4-dimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine (PubChem CID 79973320) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[(3,4-dimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(3,4-dimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79973320 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-[(3,4-dimethylcyclohexyl)oxymethyl]-1,3-benzoxazol-5-amine |
| SMILES | CC1CCC(OCc2nc3cc(N)ccc3o2)CC1C |
| InChI | InChI=1S/C16H22N2O2/c1-10-3-5-13(7-11(10)2)19-9-16-18-14-8-12(17)4-6-15(14)20-16/h4,6,8,10-11,13H,3,5,7,9,17H2,1-2H3 |
| InChIKey | WSVFCUAEQDLKBS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|