C16H22N4O — CID 79959773
2-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-1,3-benzoxazol-5-amine (PubChem CID 79959773) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79959773 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-[[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(CN3CCN(CC4CC4)CC3)nc2c1 |
| InChI | InChI=1S/C16H22N4O/c17-13-3-4-15-14(9-13)18-16(21-15)11-20-7-5-19(6-8-20)10-12-1-2-12/h3-4,9,12H,1-2,5-8,10-11,17H2 |
| InChIKey | DUVSKQGLUAJAJP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|