C16H15ClN2O2 — CID 79960342
2-[(4-chloro-2,6-dimethylphenoxy)methyl]-1,3-benzoxazol-5-amine (PubChem CID 79960342) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-[(4-chloro-2,6-dimethylphenoxy)methyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(4-chloro-2,6-dimethylphenoxy)methyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79960342 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(4-chloro-2,6-dimethylphenoxy)methyl]-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(Cl)cc(C)c1OCc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C16H15ClN2O2/c1-9-5-11(17)6-10(2)16(9)20-8-15-19-13-7-12(18)3-4-14(13)21-15/h3-7H,8,18H2,1-2H3 |
| InChIKey | HXPVNYQKXDUXPB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|