C11H11F3N2O2 — CID 82954796
2-(3,3,3-trifluoropropoxymethyl)-1,3-benzoxazol-5-amine (PubChem CID 82954796) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropoxymethyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(3,3,3-trifluoropropoxymethyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 82954796 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(3,3,3-trifluoropropoxymethyl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(COCCC(F)(F)F)nc2c1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)3-4-17-6-10-16-8-5-7(15)1-2-9(8)18-10/h1-2,5H,3-4,6,15H2 |
| InChIKey | BPPBGZPGOZVJLB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|